C18H18N4O2S2 — CID 9410258
1-[(Z)-[5-(1,3-benzothiazol-2-yl)furan-2-yl]methylideneamino]-3-[[(2S)-oxolan-2-yl]methyl]thiourea (PubChem CID 9410258) has the molecular formula C18H18N4O2S2 and a molecular weight of 386.50 g/mol. Its IUPAC name is 1-[(Z)-[5-(1,3-benzothiazol-2-yl)furan-2-yl]methylideneamino]-3-[[(2S)-oxolan-2-yl]methyl]thiourea.
| Compound Name | 1-[(Z)-[5-(1,3-benzothiazol-2-yl)furan-2-yl]methylideneamino]-3-[[(2S)-oxolan-2-yl]methyl]thiourea |
|---|---|
| PubChem CID | 9410258 |
| Molecular Formula | C18H18N4O2S2 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | 1-[(Z)-[5-(1,3-benzothiazol-2-yl)furan-2-yl]methylideneamino]-3-[[(2S)-oxolan-2-yl]methyl]thiourea |
| SMILES | S=C(NC[C@@H]1CCCO1)N/N=C\c1ccc(-c2nc3ccccc3s2)o1 |
| InChI | InChI=1S/C18H18N4O2S2/c25-18(19-10-12-4-3-9-23-12)22-20-11-13-7-8-15(24-13)17-21-14-5-1-2-6-16(14)26-17/h1-2,5-8,11-12H,3-4,9-10H2,(H2,19,22,25)/b20-11-/t12-/m0/s1 |
| InChIKey | UFIFBSGBGGEYHH-OEKFUPINSA-N |
| XLogP | 3.53 |
| TPSA | 71.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|