C19H26N2S — CID 9218009
1-(2-adamantyl)-3-(4-ethylphenyl)thiourea (PubChem CID 9218009) has the molecular formula C19H26N2S and a molecular weight of 314.50 g/mol. Its IUPAC name is 1-(2-adamantyl)-3-(4-ethylphenyl)thiourea.
| Compound Name | 1-(2-adamantyl)-3-(4-ethylphenyl)thiourea |
|---|---|
| PubChem CID | 9218009 |
| Molecular Formula | C19H26N2S |
| Molecular Weight | 314.50 g/mol |
| Exact Mass | 314.18 |
| IUPAC Name | 1-(2-adamantyl)-3-(4-ethylphenyl)thiourea |
| SMILES | CCc1ccc(NC(=S)NC2C3CC4CC(C3)CC2C4)cc1 |
| InChI | InChI=1S/C19H26N2S/c1-2-12-3-5-17(6-4-12)20-19(22)21-18-15-8-13-7-14(10-15)11-16(18)9-13/h3-6,13-16,18H,2,7-11H2,1H3,(H2,20,21,22) |
| InChIKey | SIVKSDJIDVLYDJ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.50 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|