C20H28N2O5 — CID 9236888
propyl 2-[(2S)-1-[(2S)-2-(4-ethylphenoxy)propanoyl]-3-oxopiperazin-2-yl]acetate (PubChem CID 9236888) has the molecular formula C20H28N2O5 and a molecular weight of 376.45 g/mol. Its IUPAC name is propyl 2-[(2S)-1-[(2S)-2-(4-ethylphenoxy)propanoyl]-3-oxopiperazin-2-yl]acetate.
| Compound Name | propyl 2-[(2S)-1-[(2S)-2-(4-ethylphenoxy)propanoyl]-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 9236888 |
| Molecular Formula | C20H28N2O5 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | propyl 2-[(2S)-1-[(2S)-2-(4-ethylphenoxy)propanoyl]-3-oxopiperazin-2-yl]acetate |
| SMILES | CCCOC(=O)C[C@H]1C(=O)NCCN1C(=O)[C@H](C)Oc1ccc(CC)cc1 |
| InChI | InChI=1S/C20H28N2O5/c1-4-12-26-18(23)13-17-19(24)21-10-11-22(17)20(25)14(3)27-16-8-6-15(5-2)7-9-16/h6-9,14,17H,4-5,10-13H2,1-3H3,(H,21,24)/t14-,17-/m0/s1 |
| InChIKey | ZNJDLZLUXJERRH-YOEHRIQHSA-N |
| XLogP | 1.69 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |