C22H19N7O2 — CID 9240820
N-[(Z)-[(E)-3-(1-benzyltriazol-4-yl)prop-2-enylidene]amino]-4-hydroxy-1-phenylpyrazole-3-carboxamide (PubChem CID 9240820) has the molecular formula C22H19N7O2 and a molecular weight of 413.44 g/mol. Its IUPAC name is N-[(Z)-[(E)-3-(1-benzyltriazol-4-yl)prop-2-enylidene]amino]-4-hydroxy-1-phenylpyrazole-3-carboxamide.
| Compound Name | N-[(Z)-[(E)-3-(1-benzyltriazol-4-yl)prop-2-enylidene]amino]-4-hydroxy-1-phenylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 9240820 |
| Molecular Formula | C22H19N7O2 |
| Molecular Weight | 413.44 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | N-[(Z)-[(E)-3-(1-benzyltriazol-4-yl)prop-2-enylidene]amino]-4-hydroxy-1-phenylpyrazole-3-carboxamide |
| SMILES | O=C(N/N=C\C=C\c1cn(Cc2ccccc2)nn1)c1nn(-c2ccccc2)cc1O |
| InChI | InChI=1S/C22H19N7O2/c30-20-16-29(19-11-5-2-6-12-19)26-21(20)22(31)25-23-13-7-10-18-15-28(27-24-18)14-17-8-3-1-4-9-17/h1-13,15-16,30H,14H2,(H,25,31)/b10-7+,23-13- |
| InChIKey | WZUORIISTMOJHO-LZNIEJQKSA-N |
| XLogP | 2.65 |
| TPSA | 110.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.44 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|