C22H23N5O2 — CID 9217455
N-[(Z)-[(E)-3-(1-benzyltriazol-4-yl)prop-2-enylidene]amino]-2-(3,5-dimethylphenoxy)acetamide (PubChem CID 9217455) has the molecular formula C22H23N5O2 and a molecular weight of 389.46 g/mol. Its IUPAC name is N-[(Z)-[(E)-3-(1-benzyltriazol-4-yl)prop-2-enylidene]amino]-2-(3,5-dimethylphenoxy)acetamide.
| Compound Name | N-[(Z)-[(E)-3-(1-benzyltriazol-4-yl)prop-2-enylidene]amino]-2-(3,5-dimethylphenoxy)acetamide |
|---|---|
| PubChem CID | 9217455 |
| Molecular Formula | C22H23N5O2 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | N-[(Z)-[(E)-3-(1-benzyltriazol-4-yl)prop-2-enylidene]amino]-2-(3,5-dimethylphenoxy)acetamide |
| SMILES | Cc1cc(C)cc(OCC(=O)N/N=C\C=C\c2cn(Cc3ccccc3)nn2)c1 |
| InChI | InChI=1S/C22H23N5O2/c1-17-11-18(2)13-21(12-17)29-16-22(28)25-23-10-6-9-20-15-27(26-24-20)14-19-7-4-3-5-8-19/h3-13,15H,14,16H2,1-2H3,(H,25,28)/b9-6+,23-10- |
| InChIKey | OWBLSAOPGSBVDU-FYPXMSKISA-N |
| XLogP | 3.14 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|