C12H12N4O — CID 7130902
(NZ)-N-[(E)-3-(1-benzyltriazol-4-yl)prop-2-enylidene]hydroxylamine (PubChem CID 7130902) has the molecular formula C12H12N4O and a molecular weight of 228.26 g/mol. Its IUPAC name is (NZ)-N-[(E)-3-(1-benzyltriazol-4-yl)prop-2-enylidene]hydroxylamine.
| Compound Name | (NZ)-N-[(E)-3-(1-benzyltriazol-4-yl)prop-2-enylidene]hydroxylamine |
|---|---|
| PubChem CID | 7130902 |
| Molecular Formula | C12H12N4O |
| Molecular Weight | 228.26 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | (NZ)-N-[(E)-3-(1-benzyltriazol-4-yl)prop-2-enylidene]hydroxylamine |
| SMILES | O/N=C\C=C\c1cn(Cc2ccccc2)nn1 |
| InChI | InChI=1S/C12H12N4O/c17-13-8-4-7-12-10-16(15-14-12)9-11-5-2-1-3-6-11/h1-8,10,17H,9H2/b7-4+,13-8- |
| InChIKey | RRCBRUQXMGOFAY-XOHVCTMJSA-N |
| XLogP | 1.80 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.26 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|