C21H21N5O2 — CID 9231357
N-[(Z)-[(E)-3-(1-benzyltriazol-4-yl)prop-2-enylidene]amino]-4-ethoxybenzamide (PubChem CID 9231357) has the molecular formula C21H21N5O2 and a molecular weight of 375.43 g/mol. Its IUPAC name is N-[(Z)-[(E)-3-(1-benzyltriazol-4-yl)prop-2-enylidene]amino]-4-ethoxybenzamide.
| Compound Name | N-[(Z)-[(E)-3-(1-benzyltriazol-4-yl)prop-2-enylidene]amino]-4-ethoxybenzamide |
|---|---|
| PubChem CID | 9231357 |
| Molecular Formula | C21H21N5O2 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | N-[(Z)-[(E)-3-(1-benzyltriazol-4-yl)prop-2-enylidene]amino]-4-ethoxybenzamide |
| SMILES | CCOc1ccc(C(=O)N/N=C\C=C\c2cn(Cc3ccccc3)nn2)cc1 |
| InChI | InChI=1S/C21H21N5O2/c1-2-28-20-12-10-18(11-13-20)21(27)24-22-14-6-9-19-16-26(25-23-19)15-17-7-4-3-5-8-17/h3-14,16H,2,15H2,1H3,(H,24,27)/b9-6+,22-14- |
| InChIKey | IJSPCTHBWUXELZ-OAYMULHASA-N |
| XLogP | 3.15 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|