C22H33N3O3+2 — CID 9245296
N-tert-butyl-2-[4-[(2-hydroxy-7-methoxynaphthalen-1-yl)methyl]piperazine-1,4-diium-1-yl]acetamide (PubChem CID 9245296) has the molecular formula C22H33N3O3+2 and a molecular weight of 387.52 g/mol. Its IUPAC name is N-tert-butyl-2-[4-[(2-hydroxy-7-methoxynaphthalen-1-yl)methyl]piperazine-1,4-diium-1-yl]acetamide.
| Compound Name | N-tert-butyl-2-[4-[(2-hydroxy-7-methoxynaphthalen-1-yl)methyl]piperazine-1,4-diium-1-yl]acetamide |
|---|---|
| PubChem CID | 9245296 |
| Molecular Formula | C22H33N3O3+2 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.25 |
| IUPAC Name | N-tert-butyl-2-[4-[(2-hydroxy-7-methoxynaphthalen-1-yl)methyl]piperazine-1,4-diium-1-yl]acetamide |
| SMILES | COc1ccc2ccc(O)c(C[NH+]3CC[NH+](CC(=O)NC(C)(C)C)CC3)c2c1 |
| InChI | InChI=1S/C22H31N3O3/c1-22(2,3)23-21(27)15-25-11-9-24(10-12-25)14-19-18-13-17(28-4)7-5-16(18)6-8-20(19)26/h5-8,13,26H,9-12,14-15H2,1-4H3,(H,23,27)/p+2 |
| InChIKey | PKUNWGLBKLKNSZ-UHFFFAOYSA-P |
| XLogP | -0.25 |
| TPSA | 67.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|