C13H21ClN4O+2 — CID 9250059
(2S)-N-(2-chloro-3-pyridinyl)-2-(4-methylpiperazine-1,4-diium-1-yl)propanamide (PubChem CID 9250059) has the molecular formula C13H21ClN4O+2 and a molecular weight of 284.79 g/mol. Its IUPAC name is (2S)-N-(2-chloro-3-pyridinyl)-2-(4-methylpiperazine-1,4-diium-1-yl)propanamide.
| Compound Name | (2S)-N-(2-chloro-3-pyridinyl)-2-(4-methylpiperazine-1,4-diium-1-yl)propanamide |
|---|---|
| PubChem CID | 9250059 |
| Molecular Formula | C13H21ClN4O+2 |
| Molecular Weight | 284.79 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | (2S)-N-(2-chloro-3-pyridinyl)-2-(4-methylpiperazine-1,4-diium-1-yl)propanamide |
| SMILES | C[C@@H](C(=O)Nc1cccnc1Cl)[NH+]1CC[NH+](C)CC1 |
| InChI | InChI=1S/C13H19ClN4O/c1-10(18-8-6-17(2)7-9-18)13(19)16-11-4-3-5-15-12(11)14/h3-5,10H,6-9H2,1-2H3,(H,16,19)/p+2/t10-/m0/s1 |
| InChIKey | DKZLOWLCACEZIO-JTQLQIEISA-P |
| XLogP | -1.52 |
| TPSA | 50.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.79 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|