About (2R)-2-(1H-imidazo[4,5-b]pyridin-2-ylsulfanyl)-N-(4-methylcyclohexyl)butanamide
(2R)-2-(1H-imidazo[4,5-b]pyridin-2-ylsulfanyl)-N-(4-methylcyclohexyl)butanamide (PubChem CID 92503950) has the molecular formula C17H24N4OS
and a molecular weight of 332.47 g/mol. Its IUPAC name is (2R)-2-(1H-imidazo[4,5-b]pyridin-2-ylsulfanyl)-N-(4-methylcyclohexyl)butanamide.
Molecular Properties
| Compound Name | (2R)-2-(1H-imidazo[4,5-b]pyridin-2-ylsulfanyl)-N-(4-methylcyclohexyl)butanamide |
| PubChem CID | 92503950 |
| Molecular Formula | C17H24N4OS |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | (2R)-2-(1H-imidazo[4,5-b]pyridin-2-ylsulfanyl)-N-(4-methylcyclohexyl)butanamide |
| SMILES | CC[C@@H](Sc1nc2ncccc2[nH]1)C(=O)NC1CCC(C)CC1 |
| InChI | InChI=1S/C17H24N4OS/c1-3-14(16(22)19-12-8-6-11(2)7-9-12)23-17-20-13-5-4-10-18-15(13)21-17/h4-5,10-12,14H,3,6-9H2,1-2H3,(H,19,22)(H,18,20,21)/t11?,12?,14-/m1/s1 |
| InChIKey | MQLIRPHNUZTSIW-ORHYLEIMSA-N |
| XLogP | 3.52 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2R)-2-(1H-imidazo[4,5-b]pyridin-2-ylsulfanyl)-N-(4-methylcyclohexyl)butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-(1H-imidazo[4,5-b]pyridin-2-ylsulfanyl)-N-(4-methylcyclohexyl)butanamide?
The IUPAC name of (2R)-2-(1H-imidazo[4,5-b]pyridin-2-ylsulfanyl)-N-(4-methylcyclohexyl)butanamide (CID 92503950) is (2R)-2-(1H-imidazo[4,5-b]pyridin-2-ylsulfanyl)-N-(4-methylcyclohexyl)butanamide.
What is the SMILES notation for (2R)-2-(1H-imidazo[4,5-b]pyridin-2-ylsulfanyl)-N-(4-methylcyclohexyl)butanamide?
The canonical SMILES for (2R)-2-(1H-imidazo[4,5-b]pyridin-2-ylsulfanyl)-N-(4-methylcyclohexyl)butanamide is CC[C@@H](Sc1nc2ncccc2[nH]1)C(=O)NC1CCC(C)CC1.
What is the InChIKey of (2R)-2-(1H-imidazo[4,5-b]pyridin-2-ylsulfanyl)-N-(4-methylcyclohexyl)butanamide?
The InChIKey is MQLIRPHNUZTSIW-ORHYLEIMSA-N. The full InChI is InChI=1S/C17H24N4OS/c1-3-14(16(22)19-12-8-6-11(2)7-9-12)23-17-20-13-5-4-10-18-15(13)21-17/h4-5,10-12,14H,3,6-9H2,1-2H3,(H,19,22)(H,18,20,21)/t11?,12?,14-/m1/s1.
What are the key properties of (2R)-2-(1H-imidazo[4,5-b]pyridin-2-ylsulfanyl)-N-(4-methylcyclohexyl)butanamide?
(2R)-2-(1H-imidazo[4,5-b]pyridin-2-ylsulfanyl)-N-(4-methylcyclohexyl)butanamide has a molecular weight of 332.47 g/mol, XLogP of 3.52, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-(1H-imidazo[4,5-b]pyridin-2-ylsulfanyl)-N-(4-methylcyclohexyl)butanamide is sourced from PubChem (CID 92503950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).