C21H17ClN2O3S — CID 9252271
(3E)-5-chloro-3-[[3-methoxy-4-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]methylidene]-1H-indol-2-one (PubChem CID 9252271) has the molecular formula C21H17ClN2O3S and a molecular weight of 412.90 g/mol. Its IUPAC name is (3E)-5-chloro-3-[[3-methoxy-4-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]methylidene]-1H-indol-2-one.
| Compound Name | (3E)-5-chloro-3-[[3-methoxy-4-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]methylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 9252271 |
| Molecular Formula | C21H17ClN2O3S |
| Molecular Weight | 412.90 g/mol |
| Exact Mass | 412.06 |
| IUPAC Name | (3E)-5-chloro-3-[[3-methoxy-4-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]methylidene]-1H-indol-2-one |
| SMILES | COc1cc(/C=C2/C(=O)Nc3ccc(Cl)cc32)ccc1OCc1csc(C)n1 |
| InChI | InChI=1S/C21H17ClN2O3S/c1-12-23-15(11-28-12)10-27-19-6-3-13(8-20(19)26-2)7-17-16-9-14(22)4-5-18(16)24-21(17)25/h3-9,11H,10H2,1-2H3,(H,24,25)/b17-7+ |
| InChIKey | DMLNRVPKSHPZFF-REZTVBANSA-N |
| XLogP | 5.19 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.90 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|