C17H17N3O4 — CID 92526553
(2S,3R,5R,6R)-4-(2,5-dimethoxyphenyl)-2,6-diformylpiperidine-3,5-dicarbonitrile (PubChem CID 92526553) has the molecular formula C17H17N3O4 and a molecular weight of 327.34 g/mol. Its IUPAC name is (2S,3R,5R,6R)-4-(2,5-dimethoxyphenyl)-2,6-diformylpiperidine-3,5-dicarbonitrile.
| Compound Name | (2S,3R,5R,6R)-4-(2,5-dimethoxyphenyl)-2,6-diformylpiperidine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 92526553 |
| Molecular Formula | C17H17N3O4 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | (2S,3R,5R,6R)-4-(2,5-dimethoxyphenyl)-2,6-diformylpiperidine-3,5-dicarbonitrile |
| SMILES | COc1ccc(OC)c(C2[C@@H](C#N)[C@H](C=O)N[C@H](C=O)[C@@H]2C#N)c1 |
| InChI | InChI=1S/C17H17N3O4/c1-23-10-3-4-16(24-2)11(5-10)17-12(6-18)14(8-21)20-15(9-22)13(17)7-19/h3-5,8-9,12-15,17,20H,1-2H3/t12-,13-,14-,15+,17?/m0/s1 |
| InChIKey | LPXRZNANTQCDGW-NNZQMTATSA-N |
| XLogP | 0.81 |
| TPSA | 112.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|