C21H19NO3 — CID 92527265
[(1R,3Z,4S)-2-benzoyl-3-hydroxyimino-2-bicyclo[2.2.1]heptanyl]-phenylmethanone (PubChem CID 92527265) has the molecular formula C21H19NO3 and a molecular weight of 333.39 g/mol. Its IUPAC name is [(1R,3Z,4S)-2-benzoyl-3-hydroxyimino-2-bicyclo[2.2.1]heptanyl]-phenylmethanone.
| Compound Name | [(1R,3Z,4S)-2-benzoyl-3-hydroxyimino-2-bicyclo[2.2.1]heptanyl]-phenylmethanone |
|---|---|
| PubChem CID | 92527265 |
| Molecular Formula | C21H19NO3 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | [(1R,3Z,4S)-2-benzoyl-3-hydroxyimino-2-bicyclo[2.2.1]heptanyl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)C1(C(=O)c2ccccc2)/C(=N\O)[C@H]2CC[C@@H]1C2 |
| InChI | InChI=1S/C21H19NO3/c23-19(14-7-3-1-4-8-14)21(20(24)15-9-5-2-6-10-15)17-12-11-16(13-17)18(21)22-25/h1-10,16-17,25H,11-13H2/b22-18-/t16-,17+/m0/s1 |
| InChIKey | ZUQYVXPKGUCPHN-RLFRPXQUSA-N |
| XLogP | 4.00 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|