About N-(1',5'-dimethylspiro[bicyclo[2.2.1]heptane-3,3'-bicyclo[3.1.0]hexane]-2-ylidene)hydroxylamine
N-(1',5'-dimethylspiro[bicyclo[2.2.1]heptane-3,3'-bicyclo[3.1.0]hexane]-2-ylidene)hydroxylamine (PubChem CID 164833418) has the molecular formula C14H21NO
and a molecular weight of 219.33 g/mol. Its IUPAC name is N-(1',5'-dimethylspiro[bicyclo[2.2.1]heptane-3,3'-bicyclo[3.1.0]hexane]-2-ylidene)hydroxylamine.
Molecular Properties
| Compound Name | N-(1',5'-dimethylspiro[bicyclo[2.2.1]heptane-3,3'-bicyclo[3.1.0]hexane]-2-ylidene)hydroxylamine |
| PubChem CID | 164833418 |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | N-(1',5'-dimethylspiro[bicyclo[2.2.1]heptane-3,3'-bicyclo[3.1.0]hexane]-2-ylidene)hydroxylamine |
| SMILES | CC12CC3(CC1(C)C2)C(=NO)C1CCC3C1 |
| InChI | InChI=1S/C14H21NO/c1-12-6-13(12,2)8-14(7-12)10-4-3-9(5-10)11(14)15-16/h9-10,16H,3-8H2,1-2H3 |
| InChIKey | NQQVHGGMMIFGBZ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(1',5'-dimethylspiro[bicyclo[2.2.1]heptane-3,3'-bicyclo[3.1.0]hexane]-2-ylidene)hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1',5'-dimethylspiro[bicyclo[2.2.1]heptane-3,3'-bicyclo[3.1.0]hexane]-2-ylidene)hydroxylamine?
The IUPAC name of N-(1',5'-dimethylspiro[bicyclo[2.2.1]heptane-3,3'-bicyclo[3.1.0]hexane]-2-ylidene)hydroxylamine (CID 164833418) is N-(1',5'-dimethylspiro[bicyclo[2.2.1]heptane-3,3'-bicyclo[3.1.0]hexane]-2-ylidene)hydroxylamine.
What is the SMILES notation for N-(1',5'-dimethylspiro[bicyclo[2.2.1]heptane-3,3'-bicyclo[3.1.0]hexane]-2-ylidene)hydroxylamine?
The canonical SMILES for N-(1',5'-dimethylspiro[bicyclo[2.2.1]heptane-3,3'-bicyclo[3.1.0]hexane]-2-ylidene)hydroxylamine is CC12CC3(CC1(C)C2)C(=NO)C1CCC3C1.
What is the InChIKey of N-(1',5'-dimethylspiro[bicyclo[2.2.1]heptane-3,3'-bicyclo[3.1.0]hexane]-2-ylidene)hydroxylamine?
The InChIKey is NQQVHGGMMIFGBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO/c1-12-6-13(12,2)8-14(7-12)10-4-3-9(5-10)11(14)15-16/h9-10,16H,3-8H2,1-2H3.
What are the key properties of N-(1',5'-dimethylspiro[bicyclo[2.2.1]heptane-3,3'-bicyclo[3.1.0]hexane]-2-ylidene)hydroxylamine?
N-(1',5'-dimethylspiro[bicyclo[2.2.1]heptane-3,3'-bicyclo[3.1.0]hexane]-2-ylidene)hydroxylamine has a molecular weight of 219.33 g/mol, XLogP of 3.44, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1',5'-dimethylspiro[bicyclo[2.2.1]heptane-3,3'-bicyclo[3.1.0]hexane]-2-ylidene)hydroxylamine is sourced from PubChem (CID 164833418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).