C10H16O — CID 71343219
4,4-dimethylbicyclo[3.2.1]oct-2-en-2-ol (PubChem CID 71343219) has the molecular formula C10H16O and a molecular weight of 152.24 g/mol. Its IUPAC name is 4,4-dimethylbicyclo[3.2.1]oct-2-en-2-ol.
| Compound Name | 4,4-dimethylbicyclo[3.2.1]oct-2-en-2-ol |
|---|---|
| PubChem CID | 71343219 |
| Molecular Formula | C10H16O |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.12 |
| IUPAC Name | 4,4-dimethylbicyclo[3.2.1]oct-2-en-2-ol |
| SMILES | CC1(C)C=C(O)C2CCC1C2 |
| InChI | InChI=1S/C10H16O/c1-10(2)6-9(11)7-3-4-8(10)5-7/h6-8,11H,3-5H2,1-2H3 |
| InChIKey | KAFCHUIPAMHFHM-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |