C17H24N4O — CID 92579080
5-cyclopropyl-11-(3-methylbutyl)-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one (PubChem CID 92579080) has the molecular formula C17H24N4O and a molecular weight of 300.41 g/mol. Its IUPAC name is 5-cyclopropyl-11-(3-methylbutyl)-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one.
| Compound Name | 5-cyclopropyl-11-(3-methylbutyl)-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one |
|---|---|
| PubChem CID | 92579080 |
| Molecular Formula | C17H24N4O |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | 5-cyclopropyl-11-(3-methylbutyl)-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one |
| SMILES | CC(C)CCN1CCc2nc3cc(C4CC4)[nH]n3c(=O)c2C1 |
| InChI | InChI=1S/C17H24N4O/c1-11(2)5-7-20-8-6-14-13(10-20)17(22)21-16(18-14)9-15(19-21)12-3-4-12/h9,11-12,19H,3-8,10H2,1-2H3 |
| InChIKey | HLMCNKWMXRSSPZ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |