C28H29F2N5O — CID 98116335
11-[(2-fluorophenyl)methyl]-5-[(3S)-1-[(2-fluorophenyl)methyl]piperidin-3-yl]-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one (PubChem CID 98116335) has the molecular formula C28H29F2N5O and a molecular weight of 489.57 g/mol. Its IUPAC name is 11-[(2-fluorophenyl)methyl]-5-[(3S)-1-[(2-fluorophenyl)methyl]piperidin-3-yl]-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one.
| Compound Name | 11-[(2-fluorophenyl)methyl]-5-[(3S)-1-[(2-fluorophenyl)methyl]piperidin-3-yl]-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one |
|---|---|
| PubChem CID | 98116335 |
| Molecular Formula | C28H29F2N5O |
| Molecular Weight | 489.57 g/mol |
| Exact Mass | 489.23 |
| IUPAC Name | 11-[(2-fluorophenyl)methyl]-5-[(3S)-1-[(2-fluorophenyl)methyl]piperidin-3-yl]-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one |
| SMILES | O=c1c2c(nc3cc([C@H]4CCCN(Cc5ccccc5F)C4)[nH]n13)CCN(Cc1ccccc1F)C2 |
| InChI | InChI=1S/C28H29F2N5O/c29-23-9-3-1-6-19(23)15-33-12-5-8-21(17-33)26-14-27-31-25-11-13-34(16-20-7-2-4-10-24(20)30)18-22(25)28(36)35(27)32-26/h1-4,6-7,9-10,14,21,32H,5,8,11-13,15-18H2/t21-/m0/s1 |
| InChIKey | FGLUSOBOPJUBSS-NRFANRHFSA-N |
| XLogP | 4.24 |
| TPSA | 56.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.57 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |