C25H32FN3O2 — CID 92620460
(3R,4S)-1-acetyl-4-[4-[(dimethylamino)methyl]phenyl]-N-[3-(4-fluorophenyl)propyl]pyrrolidine-3-carboxamide (PubChem CID 92620460) has the molecular formula C25H32FN3O2 and a molecular weight of 425.55 g/mol. Its IUPAC name is (3R,4S)-1-acetyl-4-[4-[(dimethylamino)methyl]phenyl]-N-[3-(4-fluorophenyl)propyl]pyrrolidine-3-carboxamide.
| Compound Name | (3R,4S)-1-acetyl-4-[4-[(dimethylamino)methyl]phenyl]-N-[3-(4-fluorophenyl)propyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 92620460 |
| Molecular Formula | C25H32FN3O2 |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.25 |
| IUPAC Name | (3R,4S)-1-acetyl-4-[4-[(dimethylamino)methyl]phenyl]-N-[3-(4-fluorophenyl)propyl]pyrrolidine-3-carboxamide |
| SMILES | CC(=O)N1C[C@H](C(=O)NCCCc2ccc(F)cc2)[C@@H](c2ccc(CN(C)C)cc2)C1 |
| InChI | InChI=1S/C25H32FN3O2/c1-18(30)29-16-23(21-10-6-20(7-11-21)15-28(2)3)24(17-29)25(31)27-14-4-5-19-8-12-22(26)13-9-19/h6-13,23-24H,4-5,14-17H2,1-3H3,(H,27,31)/t23-,24+/m1/s1 |
| InChIKey | IXRHMJLFYXXODF-RPWUZVMVSA-N |
| XLogP | 3.20 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|