C18H25FN4O2S — CID 92634917
3-fluoro-N-methyl-N-[(4R)-1-[(1-methylpyrazol-4-yl)methyl]azepan-4-yl]benzenesulfonamide (PubChem CID 92634917) has the molecular formula C18H25FN4O2S and a molecular weight of 380.49 g/mol. Its IUPAC name is 3-fluoro-N-methyl-N-[(4R)-1-[(1-methylpyrazol-4-yl)methyl]azepan-4-yl]benzenesulfonamide.
| Compound Name | 3-fluoro-N-methyl-N-[(4R)-1-[(1-methylpyrazol-4-yl)methyl]azepan-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 92634917 |
| Molecular Formula | C18H25FN4O2S |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 3-fluoro-N-methyl-N-[(4R)-1-[(1-methylpyrazol-4-yl)methyl]azepan-4-yl]benzenesulfonamide |
| SMILES | CN([C@@H]1CCCN(Cc2cnn(C)c2)CC1)S(=O)(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C18H25FN4O2S/c1-21-13-15(12-20-21)14-23-9-4-6-17(8-10-23)22(2)26(24,25)18-7-3-5-16(19)11-18/h3,5,7,11-13,17H,4,6,8-10,14H2,1-2H3/t17-/m1/s1 |
| InChIKey | YAUWTGYJIGENIR-QGZVFWFLSA-N |
| XLogP | 2.23 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |