C22H22ClN3O2 — CID 92648967
2-[2-(4-chlorophenyl)-6-oxo-1H-pyrimidin-5-yl]-N-(2,6-diethylphenyl)acetamide (PubChem CID 92648967) has the molecular formula C22H22ClN3O2 and a molecular weight of 395.89 g/mol. Its IUPAC name is 2-[2-(4-chlorophenyl)-6-oxo-1H-pyrimidin-5-yl]-N-(2,6-diethylphenyl)acetamide.
| Compound Name | 2-[2-(4-chlorophenyl)-6-oxo-1H-pyrimidin-5-yl]-N-(2,6-diethylphenyl)acetamide |
|---|---|
| PubChem CID | 92648967 |
| Molecular Formula | C22H22ClN3O2 |
| Molecular Weight | 395.89 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | 2-[2-(4-chlorophenyl)-6-oxo-1H-pyrimidin-5-yl]-N-(2,6-diethylphenyl)acetamide |
| SMILES | CCc1cccc(CC)c1NC(=O)Cc1cnc(-c2ccc(Cl)cc2)[nH]c1=O |
| InChI | InChI=1S/C22H22ClN3O2/c1-3-14-6-5-7-15(4-2)20(14)25-19(27)12-17-13-24-21(26-22(17)28)16-8-10-18(23)11-9-16/h5-11,13H,3-4,12H2,1-2H3,(H,25,27)(H,24,26,28) |
| InChIKey | JGTFBWXQOPOCRG-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.89 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |