C18H18BrClN2O2S — CID 92663668
N-[(Z)-1-(3-bromo-4-methoxyphenyl)ethylideneamino]-2-[(4-chlorophenyl)methylsulfanyl]acetamide (PubChem CID 92663668) has the molecular formula C18H18BrClN2O2S and a molecular weight of 441.78 g/mol. Its IUPAC name is N-[(Z)-1-(3-bromo-4-methoxyphenyl)ethylideneamino]-2-[(4-chlorophenyl)methylsulfanyl]acetamide.
| Compound Name | N-[(Z)-1-(3-bromo-4-methoxyphenyl)ethylideneamino]-2-[(4-chlorophenyl)methylsulfanyl]acetamide |
|---|---|
| PubChem CID | 92663668 |
| Molecular Formula | C18H18BrClN2O2S |
| Molecular Weight | 441.78 g/mol |
| Exact Mass | 440.00 |
| IUPAC Name | N-[(Z)-1-(3-bromo-4-methoxyphenyl)ethylideneamino]-2-[(4-chlorophenyl)methylsulfanyl]acetamide |
| SMILES | COc1ccc(/C(C)=N\NC(=O)CSCc2ccc(Cl)cc2)cc1Br |
| InChI | InChI=1S/C18H18BrClN2O2S/c1-12(14-5-8-17(24-2)16(19)9-14)21-22-18(23)11-25-10-13-3-6-15(20)7-4-13/h3-9H,10-11H2,1-2H3,(H,22,23)/b21-12- |
| InChIKey | XCIGHQUXYNCKFA-MTJSOVHGSA-N |
| XLogP | 4.88 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.78 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|