C29H39N5OS — CID 92668164
(3R)-N-[3-(4-benzylpiperazin-1-yl)propyl]-1-(4,6-dimethyl-1,3-benzothiazol-2-yl)piperidine-3-carboxamide (PubChem CID 92668164) has the molecular formula C29H39N5OS and a molecular weight of 505.73 g/mol. Its IUPAC name is (3R)-N-[3-(4-benzylpiperazin-1-yl)propyl]-1-(4,6-dimethyl-1,3-benzothiazol-2-yl)piperidine-3-carboxamide.
| Compound Name | (3R)-N-[3-(4-benzylpiperazin-1-yl)propyl]-1-(4,6-dimethyl-1,3-benzothiazol-2-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 92668164 |
| Molecular Formula | C29H39N5OS |
| Molecular Weight | 505.73 g/mol |
| Exact Mass | 505.29 |
| IUPAC Name | (3R)-N-[3-(4-benzylpiperazin-1-yl)propyl]-1-(4,6-dimethyl-1,3-benzothiazol-2-yl)piperidine-3-carboxamide |
| SMILES | Cc1cc(C)c2nc(N3CCC[C@@H](C(=O)NCCCN4CCN(Cc5ccccc5)CC4)C3)sc2c1 |
| InChI | InChI=1S/C29H39N5OS/c1-22-18-23(2)27-26(19-22)36-29(31-27)34-13-6-10-25(21-34)28(35)30-11-7-12-32-14-16-33(17-15-32)20-24-8-4-3-5-9-24/h3-5,8-9,18-19,25H,6-7,10-17,20-21H2,1-2H3,(H,30,35)/t25-/m1/s1 |
| InChIKey | BZOQOFUESKKRLQ-RUZDIDTESA-N |
| XLogP | 4.45 |
| TPSA | 51.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.73 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|