C17H22N2O3S2 — CID 92670087
N-[(3aR,6aS)-5,5-dioxo-3-[(1S)-1-phenylethyl]-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]butanamide (PubChem CID 92670087) has the molecular formula C17H22N2O3S2 and a molecular weight of 366.51 g/mol. Its IUPAC name is N-[(3aR,6aS)-5,5-dioxo-3-[(1S)-1-phenylethyl]-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]butanamide.
| Compound Name | N-[(3aR,6aS)-5,5-dioxo-3-[(1S)-1-phenylethyl]-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]butanamide |
|---|---|
| PubChem CID | 92670087 |
| Molecular Formula | C17H22N2O3S2 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | N-[(3aR,6aS)-5,5-dioxo-3-[(1S)-1-phenylethyl]-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]butanamide |
| SMILES | CCCC(=O)/N=C1\S[C@@H]2CS(=O)(=O)C[C@H]2N1[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C17H22N2O3S2/c1-3-7-16(20)18-17-19(12(2)13-8-5-4-6-9-13)14-10-24(21,22)11-15(14)23-17/h4-6,8-9,12,14-15H,3,7,10-11H2,1-2H3/b18-17-/t12-,14+,15+/m0/s1 |
| InChIKey | HVYUWHCEOXWNOC-JGHBPBROSA-N |
| XLogP | 2.64 |
| TPSA | 66.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|