C20H24N2O3S — CID 92672353
N-cyclopentyl-4-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)-N-methylbutanamide (PubChem CID 92672353) has the molecular formula C20H24N2O3S and a molecular weight of 372.49 g/mol. Its IUPAC name is N-cyclopentyl-4-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)-N-methylbutanamide.
| Compound Name | N-cyclopentyl-4-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)-N-methylbutanamide |
|---|---|
| PubChem CID | 92672353 |
| Molecular Formula | C20H24N2O3S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | N-cyclopentyl-4-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)-N-methylbutanamide |
| SMILES | CN(C(=O)CCCN1c2cccc3cccc(c23)S1(=O)=O)C1CCCC1 |
| InChI | InChI=1S/C20H24N2O3S/c1-21(16-9-2-3-10-16)19(23)13-6-14-22-17-11-4-7-15-8-5-12-18(20(15)17)26(22,24)25/h4-5,7-8,11-12,16H,2-3,6,9-10,13-14H2,1H3 |
| InChIKey | OBBMULGDGZEDGI-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |