C19H35N3O5S2 — CID 92687080
(3R)-1-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylsulfonyl)-N-(3-propylsulfanylpropyl)piperidine-3-carboxamide (PubChem CID 92687080) has the molecular formula C19H35N3O5S2 and a molecular weight of 449.64 g/mol. Its IUPAC name is (3R)-1-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylsulfonyl)-N-(3-propylsulfanylpropyl)piperidine-3-carboxamide.
| Compound Name | (3R)-1-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylsulfonyl)-N-(3-propylsulfanylpropyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 92687080 |
| Molecular Formula | C19H35N3O5S2 |
| Molecular Weight | 449.64 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | (3R)-1-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylsulfonyl)-N-(3-propylsulfanylpropyl)piperidine-3-carboxamide |
| SMILES | CCCSCCCNC(=O)[C@@H]1CCCN(S(=O)(=O)N2CCC3(CC2)OCCO3)C1 |
| InChI | InChI=1S/C19H35N3O5S2/c1-2-14-28-15-4-8-20-18(23)17-5-3-9-22(16-17)29(24,25)21-10-6-19(7-11-21)26-12-13-27-19/h17H,2-16H2,1H3,(H,20,23)/t17-/m1/s1 |
| InChIKey | GJYUJXHOAOQSOZ-QGZVFWFLSA-N |
| XLogP | 1.43 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.64 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|