C23H22N4O3S — CID 92694630
ethyl (3S)-1-(6-sulfanylidene-5H-benzimidazolo[1,2-c]quinazoline-3-carbonyl)piperidine-3-carboxylate (PubChem CID 92694630) has the molecular formula C23H22N4O3S and a molecular weight of 434.52 g/mol. Its IUPAC name is ethyl (3S)-1-(6-sulfanylidene-5H-benzimidazolo[1,2-c]quinazoline-3-carbonyl)piperidine-3-carboxylate.
| Compound Name | ethyl (3S)-1-(6-sulfanylidene-5H-benzimidazolo[1,2-c]quinazoline-3-carbonyl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 92694630 |
| Molecular Formula | C23H22N4O3S |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | ethyl (3S)-1-(6-sulfanylidene-5H-benzimidazolo[1,2-c]quinazoline-3-carbonyl)piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1CCCN(C(=O)c2ccc3c(c2)[nH]c(=S)n2c4ccccc4nc32)C1 |
| InChI | InChI=1S/C23H22N4O3S/c1-2-30-22(29)15-6-5-11-26(13-15)21(28)14-9-10-16-18(12-14)25-23(31)27-19-8-4-3-7-17(19)24-20(16)27/h3-4,7-10,12,15H,2,5-6,11,13H2,1H3,(H,25,31)/t15-/m0/s1 |
| InChIKey | PPTIHWQWLOBJSY-HNNXBMFYSA-N |
| XLogP | 4.11 |
| TPSA | 79.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|