C24H22N6O4 — CID 92695000
(4S)-6-amino-3-(4-methylphenyl)-4-(4-morpholin-4-yl-3-nitrophenyl)-2,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile (PubChem CID 92695000) has the molecular formula C24H22N6O4 and a molecular weight of 458.48 g/mol. Its IUPAC name is (4S)-6-amino-3-(4-methylphenyl)-4-(4-morpholin-4-yl-3-nitrophenyl)-2,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile.
| Compound Name | (4S)-6-amino-3-(4-methylphenyl)-4-(4-morpholin-4-yl-3-nitrophenyl)-2,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile |
|---|---|
| PubChem CID | 92695000 |
| Molecular Formula | C24H22N6O4 |
| Molecular Weight | 458.48 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | (4S)-6-amino-3-(4-methylphenyl)-4-(4-morpholin-4-yl-3-nitrophenyl)-2,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile |
| SMILES | Cc1ccc(-c2[nH]nc3c2[C@@H](c2ccc(N4CCOCC4)c([N+](=O)[O-])c2)C(C#N)=C(N)O3)cc1 |
| InChI | InChI=1S/C24H22N6O4/c1-14-2-4-15(5-3-14)22-21-20(17(13-25)23(26)34-24(21)28-27-22)16-6-7-18(19(12-16)30(31)32)29-8-10-33-11-9-29/h2-7,12,20H,8-11,26H2,1H3,(H,27,28)/t20-/m0/s1 |
| InChIKey | SCCYWSLFLHNBQC-FQEVSTJZSA-N |
| XLogP | 3.35 |
| TPSA | 143.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.48 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|