C22H28N4O2 — CID 92696933
N-[3-(N-ethyl-3-methylanilino)propyl]-2-[(2R)-3-oxo-2,4-dihydro-1H-quinoxalin-2-yl]acetamide (PubChem CID 92696933) has the molecular formula C22H28N4O2 and a molecular weight of 380.49 g/mol. Its IUPAC name is N-[3-(N-ethyl-3-methylanilino)propyl]-2-[(2R)-3-oxo-2,4-dihydro-1H-quinoxalin-2-yl]acetamide.
| Compound Name | N-[3-(N-ethyl-3-methylanilino)propyl]-2-[(2R)-3-oxo-2,4-dihydro-1H-quinoxalin-2-yl]acetamide |
|---|---|
| PubChem CID | 92696933 |
| Molecular Formula | C22H28N4O2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | N-[3-(N-ethyl-3-methylanilino)propyl]-2-[(2R)-3-oxo-2,4-dihydro-1H-quinoxalin-2-yl]acetamide |
| SMILES | CCN(CCCNC(=O)C[C@H]1Nc2ccccc2NC1=O)c1cccc(C)c1 |
| InChI | InChI=1S/C22H28N4O2/c1-3-26(17-9-6-8-16(2)14-17)13-7-12-23-21(27)15-20-22(28)25-19-11-5-4-10-18(19)24-20/h4-6,8-11,14,20,24H,3,7,12-13,15H2,1-2H3,(H,23,27)(H,25,28)/t20-/m1/s1 |
| InChIKey | PZVUMLGTDFMVPN-HXUWFJFHSA-N |
| XLogP | 3.15 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|