C22H27N3O2S — CID 3660980
N-[3-(N-ethyl-3-methylanilino)propyl]-2-(3-oxo-1,4-benzothiazin-4-yl)acetamide (PubChem CID 3660980) has the molecular formula C22H27N3O2S and a molecular weight of 397.54 g/mol. Its IUPAC name is N-[3-(N-ethyl-3-methylanilino)propyl]-2-(3-oxo-1,4-benzothiazin-4-yl)acetamide.
| Compound Name | N-[3-(N-ethyl-3-methylanilino)propyl]-2-(3-oxo-1,4-benzothiazin-4-yl)acetamide |
|---|---|
| PubChem CID | 3660980 |
| Molecular Formula | C22H27N3O2S |
| Molecular Weight | 397.54 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | N-[3-(N-ethyl-3-methylanilino)propyl]-2-(3-oxo-1,4-benzothiazin-4-yl)acetamide |
| SMILES | CCN(CCCNC(=O)CN1C(=O)CSc2ccccc21)c1cccc(C)c1 |
| InChI | InChI=1S/C22H27N3O2S/c1-3-24(18-9-6-8-17(2)14-18)13-7-12-23-21(26)15-25-19-10-4-5-11-20(19)28-16-22(25)27/h4-6,8-11,14H,3,7,12-13,15-16H2,1-2H3,(H,23,26) |
| InChIKey | KERWAZXMZLHXMC-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.54 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|