C26H31N3OS2 — CID 20944360
N-[3-(N-ethyl-3-methylanilino)propyl]-5-(2-methyl-2,3-dihydro-1,4-benzothiazin-4-yl)thiophene-2-carboxamide (PubChem CID 20944360) has the molecular formula C26H31N3OS2 and a molecular weight of 465.69 g/mol. Its IUPAC name is N-[3-(N-ethyl-3-methylanilino)propyl]-5-(2-methyl-2,3-dihydro-1,4-benzothiazin-4-yl)thiophene-2-carboxamide.
| Compound Name | N-[3-(N-ethyl-3-methylanilino)propyl]-5-(2-methyl-2,3-dihydro-1,4-benzothiazin-4-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 20944360 |
| Molecular Formula | C26H31N3OS2 |
| Molecular Weight | 465.69 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | N-[3-(N-ethyl-3-methylanilino)propyl]-5-(2-methyl-2,3-dihydro-1,4-benzothiazin-4-yl)thiophene-2-carboxamide |
| SMILES | CCN(CCCNC(=O)c1ccc(N2CC(C)Sc3ccccc32)s1)c1cccc(C)c1 |
| InChI | InChI=1S/C26H31N3OS2/c1-4-28(21-10-7-9-19(2)17-21)16-8-15-27-26(30)24-13-14-25(32-24)29-18-20(3)31-23-12-6-5-11-22(23)29/h5-7,9-14,17,20H,4,8,15-16,18H2,1-3H3,(H,27,30) |
| InChIKey | NSUQUDVOQCCPTI-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.69 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|