C22H26N4O4S — CID 6733987
2-(N-ethyl-3-methylanilino)ethyl N-[[2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetyl]amino]carbamate (PubChem CID 6733987) has the molecular formula C22H26N4O4S and a molecular weight of 442.54 g/mol. Its IUPAC name is 2-(N-ethyl-3-methylanilino)ethyl N-[[2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetyl]amino]carbamate.
| Compound Name | 2-(N-ethyl-3-methylanilino)ethyl N-[[2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetyl]amino]carbamate |
|---|---|
| PubChem CID | 6733987 |
| Molecular Formula | C22H26N4O4S |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | 2-(N-ethyl-3-methylanilino)ethyl N-[[2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetyl]amino]carbamate |
| SMILES | CCN(CCOC(=O)NNC(=O)CC1Sc2ccccc2NC1=O)c1cccc(C)c1 |
| InChI | InChI=1S/C22H26N4O4S/c1-3-26(16-8-6-7-15(2)13-16)11-12-30-22(29)25-24-20(27)14-19-21(28)23-17-9-4-5-10-18(17)31-19/h4-10,13,19H,3,11-12,14H2,1-2H3,(H,23,28)(H,24,27)(H,25,29) |
| InChIKey | DCQFSDUOGLCQHC-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|