C18H16N4O7 — CID 92698851
3,5-dinitro-4-[(1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]benzoic acid (PubChem CID 92698851) has the molecular formula C18H16N4O7 and a molecular weight of 400.35 g/mol. Its IUPAC name is 3,5-dinitro-4-[(1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]benzoic acid.
| Compound Name | 3,5-dinitro-4-[(1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]benzoic acid |
|---|---|
| PubChem CID | 92698851 |
| Molecular Formula | C18H16N4O7 |
| Molecular Weight | 400.35 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | 3,5-dinitro-4-[(1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]benzoic acid |
| SMILES | O=C(O)c1cc([N+](=O)[O-])c(N2C[C@H]3C[C@@H](C2)c2cccc(=O)n2C3)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H16N4O7/c23-16-3-1-2-13-12-4-10(8-20(13)16)7-19(9-12)17-14(21(26)27)5-11(18(24)25)6-15(17)22(28)29/h1-3,5-6,10,12H,4,7-9H2,(H,24,25)/t10-,12+/m1/s1 |
| InChIKey | QQCADPSZEPGUMB-PWSUYJOCSA-N |
| XLogP | 1.99 |
| TPSA | 148.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.35 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|