C20H25NO2 — CID 92706616
3-[[(1S,2R)-2-methylcyclohexyl]amino]-4-(2,4,5-trimethylphenyl)cyclobut-3-ene-1,2-dione (PubChem CID 92706616) has the molecular formula C20H25NO2 and a molecular weight of 311.43 g/mol. Its IUPAC name is 3-[[(1S,2R)-2-methylcyclohexyl]amino]-4-(2,4,5-trimethylphenyl)cyclobut-3-ene-1,2-dione.
| Compound Name | 3-[[(1S,2R)-2-methylcyclohexyl]amino]-4-(2,4,5-trimethylphenyl)cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 92706616 |
| Molecular Formula | C20H25NO2 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | 3-[[(1S,2R)-2-methylcyclohexyl]amino]-4-(2,4,5-trimethylphenyl)cyclobut-3-ene-1,2-dione |
| SMILES | Cc1cc(C)c(-c2c(N[C@H]3CCCC[C@H]3C)c(=O)c2=O)cc1C |
| InChI | InChI=1S/C20H25NO2/c1-11-7-5-6-8-16(11)21-18-17(19(22)20(18)23)15-10-13(3)12(2)9-14(15)4/h9-11,16,21H,5-8H2,1-4H3/t11-,16+/m1/s1 |
| InChIKey | GQKZQZRADNKHET-BZNIZROVSA-N |
| XLogP | 3.87 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|