C19H23NO2 — CID 93177276
3-[[(1R,2S,3S)-2,3-dimethylcyclohexyl]amino]-4-(4-methylphenyl)cyclobut-3-ene-1,2-dione (PubChem CID 93177276) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is 3-[[(1R,2S,3S)-2,3-dimethylcyclohexyl]amino]-4-(4-methylphenyl)cyclobut-3-ene-1,2-dione.
| Compound Name | 3-[[(1R,2S,3S)-2,3-dimethylcyclohexyl]amino]-4-(4-methylphenyl)cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 93177276 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | 3-[[(1R,2S,3S)-2,3-dimethylcyclohexyl]amino]-4-(4-methylphenyl)cyclobut-3-ene-1,2-dione |
| SMILES | Cc1ccc(-c2c(N[C@@H]3CCC[C@H](C)[C@@H]3C)c(=O)c2=O)cc1 |
| InChI | InChI=1S/C19H23NO2/c1-11-7-9-14(10-8-11)16-17(19(22)18(16)21)20-15-6-4-5-12(2)13(15)3/h7-10,12-13,15,20H,4-6H2,1-3H3/t12-,13-,15+/m0/s1 |
| InChIKey | ZVHTXYBUHCSHAM-KCQAQPDRSA-N |
| XLogP | 3.49 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|