C21H27NO2 — CID 93266102
3-[[(1R,2S,3S)-2,3-dimethylcyclohexyl]amino]-4-(2,4,5-trimethylphenyl)cyclobut-3-ene-1,2-dione (PubChem CID 93266102) has the molecular formula C21H27NO2 and a molecular weight of 325.45 g/mol. Its IUPAC name is 3-[[(1R,2S,3S)-2,3-dimethylcyclohexyl]amino]-4-(2,4,5-trimethylphenyl)cyclobut-3-ene-1,2-dione.
| Compound Name | 3-[[(1R,2S,3S)-2,3-dimethylcyclohexyl]amino]-4-(2,4,5-trimethylphenyl)cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 93266102 |
| Molecular Formula | C21H27NO2 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | 3-[[(1R,2S,3S)-2,3-dimethylcyclohexyl]amino]-4-(2,4,5-trimethylphenyl)cyclobut-3-ene-1,2-dione |
| SMILES | Cc1cc(C)c(-c2c(N[C@@H]3CCC[C@H](C)[C@@H]3C)c(=O)c2=O)cc1C |
| InChI | InChI=1S/C21H27NO2/c1-11-7-6-8-17(15(11)5)22-19-18(20(23)21(19)24)16-10-13(3)12(2)9-14(16)4/h9-11,15,17,22H,6-8H2,1-5H3/t11-,15-,17+/m0/s1 |
| InChIKey | GLONKYQLORTCLR-XNJJOIOASA-N |
| XLogP | 4.11 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|