C16H13BrN4O4 — CID 92713060
[2-[(2R)-3-acetyl-2-pyrazin-2-yl-2H-1,3,4-oxadiazol-5-yl]-4-bromophenyl] acetate (PubChem CID 92713060) has the molecular formula C16H13BrN4O4 and a molecular weight of 405.21 g/mol. Its IUPAC name is [2-[(2R)-3-acetyl-2-pyrazin-2-yl-2H-1,3,4-oxadiazol-5-yl]-4-bromophenyl] acetate.
| Compound Name | [2-[(2R)-3-acetyl-2-pyrazin-2-yl-2H-1,3,4-oxadiazol-5-yl]-4-bromophenyl] acetate |
|---|---|
| PubChem CID | 92713060 |
| Molecular Formula | C16H13BrN4O4 |
| Molecular Weight | 405.21 g/mol |
| Exact Mass | 404.01 |
| IUPAC Name | [2-[(2R)-3-acetyl-2-pyrazin-2-yl-2H-1,3,4-oxadiazol-5-yl]-4-bromophenyl] acetate |
| SMILES | CC(=O)Oc1ccc(Br)cc1C1=NN(C(C)=O)[C@@H](c2cnccn2)O1 |
| InChI | InChI=1S/C16H13BrN4O4/c1-9(22)21-16(13-8-18-5-6-19-13)25-15(20-21)12-7-11(17)3-4-14(12)24-10(2)23/h3-8,16H,1-2H3/t16-/m1/s1 |
| InChIKey | QMYIUWWVNCKXPT-MRXNPFEDSA-N |
| XLogP | 2.40 |
| TPSA | 93.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.21 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|