C21H25ClN2O3S2 — CID 92716718
7-chloro-N-[3-[(3S)-3-methylpiperidin-1-yl]propyl]-5,5-dioxo-4H-thieno[3,2-c]thiochromene-2-carboxamide (PubChem CID 92716718) has the molecular formula C21H25ClN2O3S2 and a molecular weight of 453.03 g/mol. Its IUPAC name is 7-chloro-N-[3-[(3S)-3-methylpiperidin-1-yl]propyl]-5,5-dioxo-4H-thieno[3,2-c]thiochromene-2-carboxamide.
| Compound Name | 7-chloro-N-[3-[(3S)-3-methylpiperidin-1-yl]propyl]-5,5-dioxo-4H-thieno[3,2-c]thiochromene-2-carboxamide |
|---|---|
| PubChem CID | 92716718 |
| Molecular Formula | C21H25ClN2O3S2 |
| Molecular Weight | 453.03 g/mol |
| Exact Mass | 452.10 |
| IUPAC Name | 7-chloro-N-[3-[(3S)-3-methylpiperidin-1-yl]propyl]-5,5-dioxo-4H-thieno[3,2-c]thiochromene-2-carboxamide |
| SMILES | C[C@H]1CCCN(CCCNC(=O)c2cc3c(s2)-c2ccc(Cl)cc2S(=O)(=O)C3)C1 |
| InChI | InChI=1S/C21H25ClN2O3S2/c1-14-4-2-8-24(12-14)9-3-7-23-21(25)18-10-15-13-29(26,27)19-11-16(22)5-6-17(19)20(15)28-18/h5-6,10-11,14H,2-4,7-9,12-13H2,1H3,(H,23,25)/t14-/m0/s1 |
| InChIKey | CLHITRWYIVNTAS-AWEZNQCLSA-N |
| XLogP | 4.21 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.03 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|