C18H24ClN3OS — CID 52537373
4-(5-chlorothiophen-2-yl)-N-[3-[(3S)-3-methylpiperidin-1-yl]propyl]-1H-pyrrole-3-carboxamide (PubChem CID 52537373) has the molecular formula C18H24ClN3OS and a molecular weight of 365.93 g/mol. Its IUPAC name is 4-(5-chlorothiophen-2-yl)-N-[3-[(3S)-3-methylpiperidin-1-yl]propyl]-1H-pyrrole-3-carboxamide.
| Compound Name | 4-(5-chlorothiophen-2-yl)-N-[3-[(3S)-3-methylpiperidin-1-yl]propyl]-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 52537373 |
| Molecular Formula | C18H24ClN3OS |
| Molecular Weight | 365.93 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | 4-(5-chlorothiophen-2-yl)-N-[3-[(3S)-3-methylpiperidin-1-yl]propyl]-1H-pyrrole-3-carboxamide |
| SMILES | C[C@H]1CCCN(CCCNC(=O)c2c[nH]cc2-c2ccc(Cl)s2)C1 |
| InChI | InChI=1S/C18H24ClN3OS/c1-13-4-2-8-22(12-13)9-3-7-21-18(23)15-11-20-10-14(15)16-5-6-17(19)24-16/h5-6,10-11,13,20H,2-4,7-9,12H2,1H3,(H,21,23)/t13-/m0/s1 |
| InChIKey | SMIKOISPGCBGMT-ZDUSSCGKSA-N |
| XLogP | 4.25 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.93 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|