C22H26N4O2S — CID 9272517
N-[(Z)-3-[2-[(4-butylphenyl)carbamothioyl]hydrazinyl]-3-oxo-1-phenylprop-1-en-2-yl]acetamide (PubChem CID 9272517) has the molecular formula C22H26N4O2S and a molecular weight of 410.54 g/mol. Its IUPAC name is N-[(Z)-3-[2-[(4-butylphenyl)carbamothioyl]hydrazinyl]-3-oxo-1-phenylprop-1-en-2-yl]acetamide.
| Compound Name | N-[(Z)-3-[2-[(4-butylphenyl)carbamothioyl]hydrazinyl]-3-oxo-1-phenylprop-1-en-2-yl]acetamide |
|---|---|
| PubChem CID | 9272517 |
| Molecular Formula | C22H26N4O2S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | N-[(Z)-3-[2-[(4-butylphenyl)carbamothioyl]hydrazinyl]-3-oxo-1-phenylprop-1-en-2-yl]acetamide |
| SMILES | CCCCc1ccc(NC(=S)NNC(=O)/C(=C/c2ccccc2)NC(C)=O)cc1 |
| InChI | InChI=1S/C22H26N4O2S/c1-3-4-8-17-11-13-19(14-12-17)24-22(29)26-25-21(28)20(23-16(2)27)15-18-9-6-5-7-10-18/h5-7,9-15H,3-4,8H2,1-2H3,(H,23,27)(H,25,28)(H2,24,26,29)/b20-15- |
| InChIKey | MIXVSIQORPJIJL-HKWRFOASSA-N |
| XLogP | 3.52 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|