C28H27N3O3 — CID 92745592
N-(2,6-dimethylphenyl)-2-[(1R)-1-(4-methoxyphenyl)-4-methyl-3-oxo-1H-pyrrolo[3,4-b]indol-2-yl]acetamide (PubChem CID 92745592) has the molecular formula C28H27N3O3 and a molecular weight of 453.54 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-2-[(1R)-1-(4-methoxyphenyl)-4-methyl-3-oxo-1H-pyrrolo[3,4-b]indol-2-yl]acetamide.
| Compound Name | N-(2,6-dimethylphenyl)-2-[(1R)-1-(4-methoxyphenyl)-4-methyl-3-oxo-1H-pyrrolo[3,4-b]indol-2-yl]acetamide |
|---|---|
| PubChem CID | 92745592 |
| Molecular Formula | C28H27N3O3 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.21 |
| IUPAC Name | N-(2,6-dimethylphenyl)-2-[(1R)-1-(4-methoxyphenyl)-4-methyl-3-oxo-1H-pyrrolo[3,4-b]indol-2-yl]acetamide |
| SMILES | COc1ccc([C@@H]2c3c(n(C)c4ccccc34)C(=O)N2CC(=O)Nc2c(C)cccc2C)cc1 |
| InChI | InChI=1S/C28H27N3O3/c1-17-8-7-9-18(2)25(17)29-23(32)16-31-26(19-12-14-20(34-4)15-13-19)24-21-10-5-6-11-22(21)30(3)27(24)28(31)33/h5-15,26H,16H2,1-4H3,(H,29,32)/t26-/m1/s1 |
| InChIKey | HUXDSXOWMLXVHL-AREMUKBSSA-N |
| XLogP | 4.99 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|