C28H30N4O2S — CID 92750683
N-[3-[[(2S)-oxolan-2-yl]methyl-(thiophen-2-ylmethyl)amino]propyl]-2-pyridin-3-ylquinoline-4-carboxamide (PubChem CID 92750683) has the molecular formula C28H30N4O2S and a molecular weight of 486.64 g/mol. Its IUPAC name is N-[3-[[(2S)-oxolan-2-yl]methyl-(thiophen-2-ylmethyl)amino]propyl]-2-pyridin-3-ylquinoline-4-carboxamide.
| Compound Name | N-[3-[[(2S)-oxolan-2-yl]methyl-(thiophen-2-ylmethyl)amino]propyl]-2-pyridin-3-ylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 92750683 |
| Molecular Formula | C28H30N4O2S |
| Molecular Weight | 486.64 g/mol |
| Exact Mass | 486.21 |
| IUPAC Name | N-[3-[[(2S)-oxolan-2-yl]methyl-(thiophen-2-ylmethyl)amino]propyl]-2-pyridin-3-ylquinoline-4-carboxamide |
| SMILES | O=C(NCCCN(Cc1cccs1)C[C@@H]1CCCO1)c1cc(-c2cccnc2)nc2ccccc12 |
| InChI | InChI=1S/C28H30N4O2S/c33-28(25-17-27(21-7-3-12-29-18-21)31-26-11-2-1-10-24(25)26)30-13-6-14-32(19-22-8-4-15-34-22)20-23-9-5-16-35-23/h1-3,5,7,9-12,16-18,22H,4,6,8,13-15,19-20H2,(H,30,33)/t22-/m0/s1 |
| InChIKey | ACIXNUVWPHXOGD-QFIPXVFZSA-N |
| XLogP | 5.16 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.64 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|