C19H35N5 — CID 92759417
2-[(2R,12R)-2,12-dimethyl-3,7,11,17-tetrazabicyclo[11.3.1]heptadeca-1(17),13,15-trien-7-yl]-N,N-dimethylethanamine (PubChem CID 92759417) has the molecular formula C19H35N5 and a molecular weight of 333.52 g/mol. Its IUPAC name is 2-[(2R,12R)-2,12-dimethyl-3,7,11,17-tetrazabicyclo[11.3.1]heptadeca-1(17),13,15-trien-7-yl]-N,N-dimethylethanamine.
| Compound Name | 2-[(2R,12R)-2,12-dimethyl-3,7,11,17-tetrazabicyclo[11.3.1]heptadeca-1(17),13,15-trien-7-yl]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 92759417 |
| Molecular Formula | C19H35N5 |
| Molecular Weight | 333.52 g/mol |
| Exact Mass | 333.29 |
| IUPAC Name | 2-[(2R,12R)-2,12-dimethyl-3,7,11,17-tetrazabicyclo[11.3.1]heptadeca-1(17),13,15-trien-7-yl]-N,N-dimethylethanamine |
| SMILES | C[C@H]1NCCCN(CCN(C)C)CCCN[C@H](C)c2cccc1n2 |
| InChI | InChI=1S/C19H35N5/c1-16-18-8-5-9-19(22-18)17(2)21-11-7-13-24(12-6-10-20-16)15-14-23(3)4/h5,8-9,16-17,20-21H,6-7,10-15H2,1-4H3/t16-,17-/m1/s1 |
| InChIKey | OZFJFCNWGUGNES-IAGOWNOFSA-N |
| XLogP | 2.04 |
| TPSA | 43.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.52 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |