C28H37N3O3 — CID 92770629
[1-benzyl-4-[[(2R)-2-ethylhexanoyl]amino]indol-5-yl] N,N-diethylcarbamate (PubChem CID 92770629) has the molecular formula C28H37N3O3 and a molecular weight of 463.62 g/mol. Its IUPAC name is [1-benzyl-4-[[(2R)-2-ethylhexanoyl]amino]indol-5-yl] N,N-diethylcarbamate.
| Compound Name | [1-benzyl-4-[[(2R)-2-ethylhexanoyl]amino]indol-5-yl] N,N-diethylcarbamate |
|---|---|
| PubChem CID | 92770629 |
| Molecular Formula | C28H37N3O3 |
| Molecular Weight | 463.62 g/mol |
| Exact Mass | 463.28 |
| IUPAC Name | [1-benzyl-4-[[(2R)-2-ethylhexanoyl]amino]indol-5-yl] N,N-diethylcarbamate |
| SMILES | CCCC[C@@H](CC)C(=O)Nc1c(OC(=O)N(CC)CC)ccc2c1ccn2Cc1ccccc1 |
| InChI | InChI=1S/C28H37N3O3/c1-5-9-15-22(6-2)27(32)29-26-23-18-19-31(20-21-13-11-10-12-14-21)24(23)16-17-25(26)34-28(33)30(7-3)8-4/h10-14,16-19,22H,5-9,15,20H2,1-4H3,(H,29,32)/t22-/m1/s1 |
| InChIKey | RFPOVLROMPFVTD-JOCHJYFZSA-N |
| XLogP | 6.69 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.62 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |