About [4-(2-chloropropanoylamino)-1-[(3-fluorophenyl)methyl]indol-5-yl] N,N-diethylcarbamate
[4-(2-chloropropanoylamino)-1-[(3-fluorophenyl)methyl]indol-5-yl] N,N-diethylcarbamate (PubChem CID 46086039) has the molecular formula C23H25ClFN3O3
and a molecular weight of 445.92 g/mol. Its IUPAC name is [4-(2-chloropropanoylamino)-1-[(3-fluorophenyl)methyl]indol-5-yl] N,N-diethylcarbamate.
Molecular Properties
| Compound Name | [4-(2-chloropropanoylamino)-1-[(3-fluorophenyl)methyl]indol-5-yl] N,N-diethylcarbamate |
| PubChem CID | 46086039 |
| Molecular Formula | C23H25ClFN3O3 |
| Molecular Weight | 445.92 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | [4-(2-chloropropanoylamino)-1-[(3-fluorophenyl)methyl]indol-5-yl] N,N-diethylcarbamate |
| SMILES | CCN(CC)C(=O)Oc1ccc2c(ccn2Cc2cccc(F)c2)c1NC(=O)C(C)Cl |
| InChI | InChI=1S/C23H25ClFN3O3/c1-4-27(5-2)23(30)31-20-10-9-19-18(21(20)26-22(29)15(3)24)11-12-28(19)14-16-7-6-8-17(25)13-16/h6-13,15H,4-5,14H2,1-3H3,(H,26,29) |
| InChIKey | ADFMPLOLPMBJRH-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 445.92 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze [4-(2-chloropropanoylamino)-1-[(3-fluorophenyl)methyl]indol-5-yl] N,N-diethylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(2-chloropropanoylamino)-1-[(3-fluorophenyl)methyl]indol-5-yl] N,N-diethylcarbamate?
The IUPAC name of [4-(2-chloropropanoylamino)-1-[(3-fluorophenyl)methyl]indol-5-yl] N,N-diethylcarbamate (CID 46086039) is [4-(2-chloropropanoylamino)-1-[(3-fluorophenyl)methyl]indol-5-yl] N,N-diethylcarbamate.
What is the SMILES notation for [4-(2-chloropropanoylamino)-1-[(3-fluorophenyl)methyl]indol-5-yl] N,N-diethylcarbamate?
The canonical SMILES for [4-(2-chloropropanoylamino)-1-[(3-fluorophenyl)methyl]indol-5-yl] N,N-diethylcarbamate is CCN(CC)C(=O)Oc1ccc2c(ccn2Cc2cccc(F)c2)c1NC(=O)C(C)Cl.
What is the InChIKey of [4-(2-chloropropanoylamino)-1-[(3-fluorophenyl)methyl]indol-5-yl] N,N-diethylcarbamate?
The InChIKey is ADFMPLOLPMBJRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H25ClFN3O3/c1-4-27(5-2)23(30)31-20-10-9-19-18(21(20)26-22(29)15(3)24)11-12-28(19)14-16-7-6-8-17(25)13-16/h6-13,15H,4-5,14H2,1-3H3,(H,26,29).
What are the key properties of [4-(2-chloropropanoylamino)-1-[(3-fluorophenyl)methyl]indol-5-yl] N,N-diethylcarbamate?
[4-(2-chloropropanoylamino)-1-[(3-fluorophenyl)methyl]indol-5-yl] N,N-diethylcarbamate has a molecular weight of 445.92 g/mol, XLogP of 5.24, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(2-chloropropanoylamino)-1-[(3-fluorophenyl)methyl]indol-5-yl] N,N-diethylcarbamate is sourced from PubChem (CID 46086039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).