C23H25Cl2N3O3 — CID 92770922
[1-[(2-chlorophenyl)methyl]-4-[[(2S)-2-chloropropanoyl]amino]indol-5-yl] N,N-diethylcarbamate (PubChem CID 92770922) has the molecular formula C23H25Cl2N3O3 and a molecular weight of 462.38 g/mol. Its IUPAC name is [1-[(2-chlorophenyl)methyl]-4-[[(2S)-2-chloropropanoyl]amino]indol-5-yl] N,N-diethylcarbamate.
| Compound Name | [1-[(2-chlorophenyl)methyl]-4-[[(2S)-2-chloropropanoyl]amino]indol-5-yl] N,N-diethylcarbamate |
|---|---|
| PubChem CID | 92770922 |
| Molecular Formula | C23H25Cl2N3O3 |
| Molecular Weight | 462.38 g/mol |
| Exact Mass | 461.13 |
| IUPAC Name | [1-[(2-chlorophenyl)methyl]-4-[[(2S)-2-chloropropanoyl]amino]indol-5-yl] N,N-diethylcarbamate |
| SMILES | CCN(CC)C(=O)Oc1ccc2c(ccn2Cc2ccccc2Cl)c1NC(=O)[C@H](C)Cl |
| InChI | InChI=1S/C23H25Cl2N3O3/c1-4-27(5-2)23(30)31-20-11-10-19-17(21(20)26-22(29)15(3)24)12-13-28(19)14-16-8-6-7-9-18(16)25/h6-13,15H,4-5,14H2,1-3H3,(H,26,29)/t15-/m0/s1 |
| InChIKey | DZFARPRIGUPPDM-HNNXBMFYSA-N |
| XLogP | 5.75 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.38 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|