C24H24N2O5 — CID 92816832
N-[(3aS,4S,7aR)-2-(4-methoxyphenyl)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-4-yl]-2-(3-methylphenoxy)acetamide (PubChem CID 92816832) has the molecular formula C24H24N2O5 and a molecular weight of 420.47 g/mol. Its IUPAC name is N-[(3aS,4S,7aR)-2-(4-methoxyphenyl)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-4-yl]-2-(3-methylphenoxy)acetamide.
| Compound Name | N-[(3aS,4S,7aR)-2-(4-methoxyphenyl)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-4-yl]-2-(3-methylphenoxy)acetamide |
|---|---|
| PubChem CID | 92816832 |
| Molecular Formula | C24H24N2O5 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | N-[(3aS,4S,7aR)-2-(4-methoxyphenyl)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-4-yl]-2-(3-methylphenoxy)acetamide |
| SMILES | COc1ccc(N2C(=O)[C@@H]3[C@@H](NC(=O)COc4cccc(C)c4)C=CC[C@H]3C2=O)cc1 |
| InChI | InChI=1S/C24H24N2O5/c1-15-5-3-6-18(13-15)31-14-21(27)25-20-8-4-7-19-22(20)24(29)26(23(19)28)16-9-11-17(30-2)12-10-16/h3-6,8-13,19-20,22H,7,14H2,1-2H3,(H,25,27)/t19-,20+,22+/m1/s1 |
| InChIKey | RGCCJKOSPLTQPG-URVUXULASA-N |
| XLogP | 2.63 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|