C19H17N3O — CID 928519
(3R,3'R)-3'-methylspiro[1H-indole-3,1'-2,3,4,9-tetrahydropyrido[3,4-b]indole]-2-one (PubChem CID 928519) has the molecular formula C19H17N3O and a molecular weight of 303.37 g/mol. Its IUPAC name is (3R,3'R)-3'-methylspiro[1H-indole-3,1'-2,3,4,9-tetrahydropyrido[3,4-b]indole]-2-one.
| Compound Name | (3R,3'R)-3'-methylspiro[1H-indole-3,1'-2,3,4,9-tetrahydropyrido[3,4-b]indole]-2-one |
|---|---|
| PubChem CID | 928519 |
| Molecular Formula | C19H17N3O |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | (3R,3'R)-3'-methylspiro[1H-indole-3,1'-2,3,4,9-tetrahydropyrido[3,4-b]indole]-2-one |
| SMILES | C[C@@H]1Cc2c([nH]c3ccccc23)[C@@]2(N1)C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C19H17N3O/c1-11-10-13-12-6-2-4-8-15(12)20-17(13)19(22-11)14-7-3-5-9-16(14)21-18(19)23/h2-9,11,20,22H,10H2,1H3,(H,21,23)/t11-,19-/m1/s1 |
| InChIKey | BVTYYZQREOKDJA-NSPYISDASA-N |
| XLogP | 2.90 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |