C6H15NO9S3 — CID 92855665
(1R)-1-[[(1R)-1-sulfoethyl]-[(1S)-1-sulfoethyl]amino]ethanesulfonic acid (PubChem CID 92855665) has the molecular formula C6H15NO9S3 and a molecular weight of 341.39 g/mol. Its IUPAC name is (1R)-1-[[(1R)-1-sulfoethyl]-[(1S)-1-sulfoethyl]amino]ethanesulfonic acid.
| Compound Name | (1R)-1-[[(1R)-1-sulfoethyl]-[(1S)-1-sulfoethyl]amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 92855665 |
| Molecular Formula | C6H15NO9S3 |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 340.99 |
| IUPAC Name | (1R)-1-[[(1R)-1-sulfoethyl]-[(1S)-1-sulfoethyl]amino]ethanesulfonic acid |
| SMILES | C[C@H](N([C@@H](C)S(=O)(=O)O)[C@H](C)S(=O)(=O)O)S(=O)(=O)O |
| InChI | InChI=1S/C6H15NO9S3/c1-4(17(8,9)10)7(5(2)18(11,12)13)6(3)19(14,15)16/h4-6H,1-3H3,(H,8,9,10)(H,11,12,13)(H,14,15,16)/t4-,5-,6+/m1/s1 |
| InChIKey | RFKRECFVGSSJCM-PBXRRBTRSA-N |
| XLogP | -1.01 |
| TPSA | 166.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|