C20H23NO — CID 92855941
(1S,3S)-3-phenyl-1-[(2S)-piperidin-2-yl]-2,3-dihydroinden-1-ol (PubChem CID 92855941) has the molecular formula C20H23NO and a molecular weight of 293.41 g/mol. Its IUPAC name is (1S,3S)-3-phenyl-1-[(2S)-piperidin-2-yl]-2,3-dihydroinden-1-ol.
| Compound Name | (1S,3S)-3-phenyl-1-[(2S)-piperidin-2-yl]-2,3-dihydroinden-1-ol |
|---|---|
| PubChem CID | 92855941 |
| Molecular Formula | C20H23NO |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | (1S,3S)-3-phenyl-1-[(2S)-piperidin-2-yl]-2,3-dihydroinden-1-ol |
| SMILES | O[C@@]1([C@@H]2CCCCN2)C[C@@H](c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C20H23NO/c22-20(19-12-6-7-13-21-19)14-17(15-8-2-1-3-9-15)16-10-4-5-11-18(16)20/h1-5,8-11,17,19,21-22H,6-7,12-14H2/t17-,19-,20-/m0/s1 |
| InChIKey | BVCSKXTWXLPCHL-IHPCNDPISA-N |
| XLogP | 3.55 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |