C15H21NO2 — CID 125497415
(2R)-2-(2-phenyl-1,3-dioxan-2-yl)piperidine (PubChem CID 125497415) has the molecular formula C15H21NO2 and a molecular weight of 247.34 g/mol. Its IUPAC name is (2R)-2-(2-phenyl-1,3-dioxan-2-yl)piperidine.
| Compound Name | (2R)-2-(2-phenyl-1,3-dioxan-2-yl)piperidine |
|---|---|
| PubChem CID | 125497415 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | (2R)-2-(2-phenyl-1,3-dioxan-2-yl)piperidine |
| SMILES | c1ccc(C2([C@H]3CCCCN3)OCCCO2)cc1 |
| InChI | InChI=1S/C15H21NO2/c1-2-7-13(8-3-1)15(17-11-6-12-18-15)14-9-4-5-10-16-14/h1-3,7-8,14,16H,4-6,9-12H2/t14-/m1/s1 |
| InChIKey | XESVVSFCBZYBHF-CQSZACIVSA-N |
| XLogP | 2.42 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |